Anisoyl chloride

Anisoyl chloride

Other names Methoxybenzoyl chloride
Identifiers
ChemSpider	21106136^Y
Jmol-3D images	Image 1
SMILES COc1ccc(cc1)C(Cl)=O
InChI InChI=1S/C8H7ClO2/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3^Y Key: MXMOTZIXVICDSD-UHFFFAOYSA-N^Y InChI=1/C8H7ClO2/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3 Key: MXMOTZIXVICDSD-UHFFFAOYAC
Properties
Molecular formula	C₈H₇ClO₂
Molar mass	170.59 g mol⁻¹
Y (verify) (what is: Y/N?) Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa)
Infobox references

Anisoyl chloride (also called methoxybenzoyl chloride) is an acyl halide, specifically an aromatic acyl chloride, and may be formed from anisic acid by replacing a hydroxyl group with a chloride group. There are three isomers, the ortho-, meta-, and para- forms.